C16H25NO — CID 155108403
N-[(E,2E)-4-cyclopropyl-5-methyl-2-prop-2-enylidenehept-3-enyl]acetamide (PubChem CID 155108403) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is N-[(E,2E)-4-cyclopropyl-5-methyl-2-prop-2-enylidenehept-3-enyl]acetamide.
| Compound Name | N-[(E,2E)-4-cyclopropyl-5-methyl-2-prop-2-enylidenehept-3-enyl]acetamide |
|---|---|
| PubChem CID | 155108403 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-[(E,2E)-4-cyclopropyl-5-methyl-2-prop-2-enylidenehept-3-enyl]acetamide |
| SMILES | C=C/C=C(\C=C(/C(C)CC)C1CC1)CNC(C)=O |
| InChI | InChI=1S/C16H25NO/c1-5-7-14(11-17-13(4)18)10-16(12(3)6-2)15-8-9-15/h5,7,10,12,15H,1,6,8-9,11H2,2-4H3,(H,17,18)/b14-7+,16-10+ |
| InChIKey | PZRKIZYTTNBLEH-VLKOFYMLSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|