C9H13NS — CID 143081819
N-[(2E)-2-ethenylpenta-2,4-dienyl]ethanethioamide (PubChem CID 143081819) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is N-[(2E)-2-ethenylpenta-2,4-dienyl]ethanethioamide.
| Compound Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]ethanethioamide |
|---|---|
| PubChem CID | 143081819 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | N-[(2E)-2-ethenylpenta-2,4-dienyl]ethanethioamide |
| SMILES | C=C/C=C(\C=C)CNC(C)=S |
| InChI | InChI=1S/C9H13NS/c1-4-6-9(5-2)7-10-8(3)11/h4-6H,1-2,7H2,3H3,(H,10,11)/b9-6+ |
| InChIKey | IMEPNNIFQXBKJN-RMKNXTFCSA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|