C9H13NO2Y — CID 154661209
[(3Z)-3-ethenylhexa-3,5-dienyl]carbamic acid;yttrium (PubChem CID 154661209) has the molecular formula C9H13NO2Y and a molecular weight of 256.11 g/mol. Its IUPAC name is [(3Z)-3-ethenylhexa-3,5-dienyl]carbamic acid;yttrium.
| Compound Name | [(3Z)-3-ethenylhexa-3,5-dienyl]carbamic acid;yttrium |
|---|---|
| PubChem CID | 154661209 |
| Molecular Formula | C9H13NO2Y |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | [(3Z)-3-ethenylhexa-3,5-dienyl]carbamic acid;yttrium |
| SMILES | C=C/C=C(\C=C)CCNC(=O)O.[Y] |
| InChI | InChI=1S/C9H13NO2.Y/c1-3-5-8(4-2)6-7-10-9(11)12;/h3-5,10H,1-2,6-7H2,(H,11,12);/b8-5+; |
| InChIKey | KVSNYTCWDJIGRW-HAAWTFQLSA-N |
| XLogP | 1.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|