C20H31N3O3 — CID 162387534
(E)-N-[(3Z)-3-ethenylhexa-3,5-dienyl]-2-(octanoylamino)but-2-enediamide (PubChem CID 162387534) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is (E)-N-[(3Z)-3-ethenylhexa-3,5-dienyl]-2-(octanoylamino)but-2-enediamide.
| Compound Name | (E)-N-[(3Z)-3-ethenylhexa-3,5-dienyl]-2-(octanoylamino)but-2-enediamide |
|---|---|
| PubChem CID | 162387534 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (E)-N-[(3Z)-3-ethenylhexa-3,5-dienyl]-2-(octanoylamino)but-2-enediamide |
| SMILES | C=C/C=C(\C=C)CCNC(=O)/C(=C\C(N)=O)NC(=O)CCCCCCC |
| InChI | InChI=1S/C20H31N3O3/c1-4-7-8-9-10-12-19(25)23-17(15-18(21)24)20(26)22-14-13-16(6-3)11-5-2/h5-6,11,15H,2-4,7-10,12-14H2,1H3,(H2,21,24)(H,22,26)(H,23,25)/b16-11+,17-15+ |
| InChIKey | NNGXZKVNHFUAFC-HQJKSCAWSA-N |
| XLogP | 2.64 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|