About N-carbamoyloctanamide
N-carbamoyloctanamide (PubChem CID 24740663) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is N-carbamoyloctanamide.
Molecular Properties
| Compound Name | N-carbamoyloctanamide |
| PubChem CID | 24740663 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | N-carbamoyloctanamide |
| SMILES | CCCCCCCC(=O)NC(N)=O |
| InChI | InChI=1S/C9H18N2O2/c1-2-3-4-5-6-7-8(12)11-9(10)13/h2-7H2,1H3,(H3,10,11,12,13) |
| InChIKey | POXQLKNLEMUXAX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-carbamoyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamoyloctanamide?
The IUPAC name of N-carbamoyloctanamide (CID 24740663) is N-carbamoyloctanamide.
What is the SMILES notation for N-carbamoyloctanamide?
The canonical SMILES for N-carbamoyloctanamide is CCCCCCCC(=O)NC(N)=O.
What is the InChIKey of N-carbamoyloctanamide?
The InChIKey is POXQLKNLEMUXAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-2-3-4-5-6-7-8(12)11-9(10)13/h2-7H2,1H3,(H3,10,11,12,13).
What are the key properties of N-carbamoyloctanamide?
N-carbamoyloctanamide has a molecular weight of 186.25 g/mol, XLogP of 1.54, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamoyloctanamide is sourced from PubChem (CID 24740663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).