C9H13NO — CID 156731692
N-[(3Z)-3-ethenylhexa-3,5-dienyl]formamide (PubChem CID 156731692) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is N-[(3Z)-3-ethenylhexa-3,5-dienyl]formamide.
| Compound Name | N-[(3Z)-3-ethenylhexa-3,5-dienyl]formamide |
|---|---|
| PubChem CID | 156731692 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-[(3Z)-3-ethenylhexa-3,5-dienyl]formamide |
| SMILES | C=C/C=C(\C=C)CCNC=O |
| InChI | InChI=1S/C9H13NO/c1-3-5-9(4-2)6-7-10-8-11/h3-5,8H,1-2,6-7H2,(H,10,11)/b9-5+ |
| InChIKey | FZWIRXCNOGIEIY-WEVVVXLNSA-N |
| XLogP | 1.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|