C10H14N2OS — CID 143768607
(3Z)-3-ethenyl-N-(methylcarbamothioyl)hexa-3,5-dienamide (PubChem CID 143768607) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is (3Z)-3-ethenyl-N-(methylcarbamothioyl)hexa-3,5-dienamide.
| Compound Name | (3Z)-3-ethenyl-N-(methylcarbamothioyl)hexa-3,5-dienamide |
|---|---|
| PubChem CID | 143768607 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (3Z)-3-ethenyl-N-(methylcarbamothioyl)hexa-3,5-dienamide |
| SMILES | C=C/C=C(\C=C)CC(=O)NC(=S)NC |
| InChI | InChI=1S/C10H14N2OS/c1-4-6-8(5-2)7-9(13)12-10(14)11-3/h4-6H,1-2,7H2,3H3,(H2,11,12,13,14)/b8-6+ |
| InChIKey | ZBISTLCPBCUCSQ-SOFGYWHQSA-N |
| XLogP | 1.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|