C14H16N2O — CID 143113299
(3Z)-N-(4-aminophenyl)-3-ethenylhexa-3,5-dienamide (PubChem CID 143113299) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is (3Z)-N-(4-aminophenyl)-3-ethenylhexa-3,5-dienamide.
| Compound Name | (3Z)-N-(4-aminophenyl)-3-ethenylhexa-3,5-dienamide |
|---|---|
| PubChem CID | 143113299 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (3Z)-N-(4-aminophenyl)-3-ethenylhexa-3,5-dienamide |
| SMILES | C=C/C=C(\C=C)CC(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C14H16N2O/c1-3-5-11(4-2)10-14(17)16-13-8-6-12(15)7-9-13/h3-9H,1-2,10,15H2,(H,16,17)/b11-5+ |
| InChIKey | BNLNUIOVSNHCPI-VZUCSPMQSA-N |
| XLogP | 2.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|