C15H24N4O — CID 155597446
(Z)-N-(5-amino-2-pyridinyl)-3-ethenylhept-3-enamide;methanamine (PubChem CID 155597446) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is (Z)-N-(5-amino-2-pyridinyl)-3-ethenylhept-3-enamide;methanamine.
| Compound Name | (Z)-N-(5-amino-2-pyridinyl)-3-ethenylhept-3-enamide;methanamine |
|---|---|
| PubChem CID | 155597446 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | (Z)-N-(5-amino-2-pyridinyl)-3-ethenylhept-3-enamide;methanamine |
| SMILES | C=C/C(=C\CCC)CC(=O)Nc1ccc(N)cn1.CN |
| InChI | InChI=1S/C14H19N3O.CH5N/c1-3-5-6-11(4-2)9-14(18)17-13-8-7-12(15)10-16-13;1-2/h4,6-8,10H,2-3,5,9,15H2,1H3,(H,16,17,18);2H2,1H3/b11-6+; |
| InChIKey | SRUTUDFBMBGSBC-ICSBZGNSSA-N |
| XLogP | 2.48 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|