C22H26N4O — CID 144755659
(Z)-N-[4-[6-(1-aminoethylideneamino)-3-pyridinyl]phenyl]-3-ethenylhept-3-enamide (PubChem CID 144755659) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is (Z)-N-[4-[6-(1-aminoethylideneamino)-3-pyridinyl]phenyl]-3-ethenylhept-3-enamide.
| Compound Name | (Z)-N-[4-[6-(1-aminoethylideneamino)-3-pyridinyl]phenyl]-3-ethenylhept-3-enamide |
|---|---|
| PubChem CID | 144755659 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (Z)-N-[4-[6-(1-aminoethylideneamino)-3-pyridinyl]phenyl]-3-ethenylhept-3-enamide |
| SMILES | C=C/C(=C\CCC)CC(=O)Nc1ccc(-c2ccc(/N=C(\C)N)nc2)cc1 |
| InChI | InChI=1S/C22H26N4O/c1-4-6-7-17(5-2)14-22(27)26-20-11-8-18(9-12-20)19-10-13-21(24-15-19)25-16(3)23/h5,7-13,15H,2,4,6,14H2,1,3H3,(H,26,27)(H2,23,24,25)/b17-7+ |
| InChIKey | DDUREZQYTMLPLV-REZTVBANSA-N |
| XLogP | 5.00 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|