C10H15N3O2 — CID 150685008
butan-2-yl N-(5-amino-2-pyridinyl)carbamate (PubChem CID 150685008) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is butan-2-yl N-(5-amino-2-pyridinyl)carbamate.
| Compound Name | butan-2-yl N-(5-amino-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 150685008 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | butan-2-yl N-(5-amino-2-pyridinyl)carbamate |
| SMILES | CCC(C)OC(=O)Nc1ccc(N)cn1 |
| InChI | InChI=1S/C10H15N3O2/c1-3-7(2)15-10(14)13-9-5-4-8(11)6-12-9/h4-7H,3,11H2,1-2H3,(H,12,13,14) |
| InChIKey | JIRBEGSMOAAUEJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |