C14H19N — CID 144567839
(2E,4Z)-N-[(2E)-2-ethenylpenta-2,4-dienyl]hepta-2,4,6-trien-3-amine (PubChem CID 144567839) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (2E,4Z)-N-[(2E)-2-ethenylpenta-2,4-dienyl]hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-N-[(2E)-2-ethenylpenta-2,4-dienyl]hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 144567839 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (2E,4Z)-N-[(2E)-2-ethenylpenta-2,4-dienyl]hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C\C(=C/C)NC/C(C=C)=C/C=C |
| InChI | InChI=1S/C14H19N/c1-5-9-11-14(8-4)15-12-13(7-3)10-6-2/h5-11,15H,1-3,12H2,4H3/b11-9-,13-10+,14-8+ |
| InChIKey | ZESNYXLLJOVISP-COQGYTDUSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|