C10H19N — CID 143049529
(2E,4Z)-N-ethylhepta-2,4,6-trien-3-amine;methane (PubChem CID 143049529) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (2E,4Z)-N-ethylhepta-2,4,6-trien-3-amine;methane.
| Compound Name | (2E,4Z)-N-ethylhepta-2,4,6-trien-3-amine;methane |
|---|---|
| PubChem CID | 143049529 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (2E,4Z)-N-ethylhepta-2,4,6-trien-3-amine;methane |
| SMILES | C.C=C/C=C\C(=C/C)NCC |
| InChI | InChI=1S/C9H15N.CH4/c1-4-7-8-9(5-2)10-6-3;/h4-5,7-8,10H,1,6H2,2-3H3;1H4/b8-7-,9-5+; |
| InChIKey | AFXAIXLUJKYSFI-KQWNQWHXSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|