C15H19N — CID 170401360
(3E,5Z)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]octa-1,3,5,7-tetraen-4-amine (PubChem CID 170401360) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is (3E,5Z)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]octa-1,3,5,7-tetraen-4-amine.
| Compound Name | (3E,5Z)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]octa-1,3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 170401360 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (3E,5Z)-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]octa-1,3,5,7-tetraen-4-amine |
| SMILES | C=C/C=C\C(=C/C)NC(/C=C\C=C)=C/C=C |
| InChI | InChI=1S/C15H19N/c1-5-9-12-14(8-4)16-15(11-7-3)13-10-6-2/h5-13,16H,1-3H2,4H3/b12-9-,13-10-,14-8+,15-11+ |
| InChIKey | JDRPZYLWGLGDDA-ALGHBOFHSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|