C17H20N2O — CID 134386892
1,3-bis[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]urea (PubChem CID 134386892) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 1,3-bis[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]urea.
| Compound Name | 1,3-bis[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]urea |
|---|---|
| PubChem CID | 134386892 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1,3-bis[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]urea |
| SMILES | C=C/C=C\C(=C/C=C)NC(=O)NC(/C=C\C=C)=C/C=C |
| InChI | InChI=1S/C17H20N2O/c1-5-9-13-15(11-7-3)18-17(20)19-16(12-8-4)14-10-6-2/h5-14H,1-4H2,(H2,18,19,20)/b13-9-,14-10-,15-11+,16-12+ |
| InChIKey | LZDGOJOQBRPKIE-NTJPYOIESA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|