C9H13NO — CID 129215041
N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]acetamide (PubChem CID 129215041) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]acetamide.
| Compound Name | N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]acetamide |
|---|---|
| PubChem CID | 129215041 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]acetamide |
| SMILES | C=C/C=C\C(=C/C)NC(C)=O |
| InChI | InChI=1S/C9H13NO/c1-4-6-7-9(5-2)10-8(3)11/h4-7H,1H2,2-3H3,(H,10,11)/b7-6-,9-5+ |
| InChIKey | INEXWDRXMBFXHQ-QRLJIZSYSA-N |
| XLogP | 1.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|