C17H27NO2 — CID 87171123
2-cyclohexylpropan-2-yl N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]carbamate (PubChem CID 87171123) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]carbamate.
| Compound Name | 2-cyclohexylpropan-2-yl N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]carbamate |
|---|---|
| PubChem CID | 87171123 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-cyclohexylpropan-2-yl N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]carbamate |
| SMILES | C=C/C=C\C(=C/C)NC(=O)OC(C)(C)C1CCCCC1 |
| InChI | InChI=1S/C17H27NO2/c1-5-7-13-15(6-2)18-16(19)20-17(3,4)14-11-9-8-10-12-14/h5-7,13-14H,1,8-12H2,2-4H3,(H,18,19)/b13-7-,15-6+ |
| InChIKey | ORZCLJJTXPMPJQ-SPROSFARSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|