About 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate
2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate (PubChem CID 144518122) has the molecular formula C19H36O2
and a molecular weight of 296.50 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate.
Analyze 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate?
The IUPAC name of 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate (CID 144518122) is 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate.
What is the SMILES notation for 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate?
The canonical SMILES for 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate is CCC(C)(CC(C)(C)C)C(=O)OC(C)(C)C1CCCCC1.
What is the InChIKey of 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate?
The InChIKey is QHYQGJNXSKITER-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O2/c1-8-19(7,14-17(2,3)4)16(20)21-18(5,6)15-12-10-9-11-13-15/h15H,8-14H2,1-7H3.
What are the key properties of 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate?
2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate has a molecular weight of 296.50 g/mol, XLogP of 5.74, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylpropan-2-yl 2-ethyl-2,4,4-trimethylpentanoate is sourced from PubChem (CID 144518122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).