C19H36O2 — CID 123782316
2-cyclohexylpropan-2-yl 2-tert-butyl-2-methylpentanoate (PubChem CID 123782316) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 2-tert-butyl-2-methylpentanoate.
| Compound Name | 2-cyclohexylpropan-2-yl 2-tert-butyl-2-methylpentanoate |
|---|---|
| PubChem CID | 123782316 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | 2-cyclohexylpropan-2-yl 2-tert-butyl-2-methylpentanoate |
| SMILES | CCCC(C)(C(=O)OC(C)(C)C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C19H36O2/c1-8-14-19(7,17(2,3)4)16(20)21-18(5,6)15-12-10-9-11-13-15/h15H,8-14H2,1-7H3 |
| InChIKey | TZHJHUJOAYZVQB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |