C20H36O2 — CID 123993040
2-cycloheptylpropan-2-yl 2-methyl-2-(1-methylcyclopropyl)pentanoate (PubChem CID 123993040) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-cycloheptylpropan-2-yl 2-methyl-2-(1-methylcyclopropyl)pentanoate.
| Compound Name | 2-cycloheptylpropan-2-yl 2-methyl-2-(1-methylcyclopropyl)pentanoate |
|---|---|
| PubChem CID | 123993040 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 2-cycloheptylpropan-2-yl 2-methyl-2-(1-methylcyclopropyl)pentanoate |
| SMILES | CCCC(C)(C(=O)OC(C)(C)C1CCCCCC1)C1(C)CC1 |
| InChI | InChI=1S/C20H36O2/c1-6-13-20(5,19(4)14-15-19)17(21)22-18(2,3)16-11-9-7-8-10-12-16/h16H,6-15H2,1-5H3 |
| InChIKey | FLZLHLOLTDTTBM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |