2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate

C17H30O3 — CID 123394574

IUPAC2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate
SMILESCC=C(C)OCCCC(=O)OC(C)(C)C1CCCCC1
InChIInChI=1S/C17H30O3/c1-5-14(2)19-13-9-12-16(18)20-17(3,4)15-10-7-6-8-11-15/h5,15H,6-13H2,1-4H3
InChIKeyJYMXAQFMHKIFGP-UHFFFAOYSA-N
MW282.42 g/mol
LogP4.61
Rot. Bonds7

About 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate

2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate (PubChem CID 123394574) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate.

Molecular Properties

Compound Name2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate
PubChem CID123394574
Molecular FormulaC17H30O3
Molecular Weight282.42 g/mol
Exact Mass282.22
IUPAC Name2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate
SMILESCC=C(C)OCCCC(=O)OC(C)(C)C1CCCCC1
InChIInChI=1S/C17H30O3/c1-5-14(2)19-13-9-12-16(18)20-17(3,4)15-10-7-6-8-11-15/h5,15H,6-13H2,1-4H3
InChIKeyJYMXAQFMHKIFGP-UHFFFAOYSA-N
XLogP4.61
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.42
LogP ≤ 54.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate?
The IUPAC name of 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate (CID 123394574) is 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate.
What is the SMILES notation for 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate?
The canonical SMILES for 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate is CC=C(C)OCCCC(=O)OC(C)(C)C1CCCCC1.
What is the InChIKey of 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate?
The InChIKey is JYMXAQFMHKIFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O3/c1-5-14(2)19-13-9-12-16(18)20-17(3,4)15-10-7-6-8-11-15/h5,15H,6-13H2,1-4H3.
What are the key properties of 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate?
2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate has a molecular weight of 282.42 g/mol, XLogP of 4.61, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylpropan-2-yl 4-but-2-en-2-yloxybutanoate is sourced from PubChem (CID 123394574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).