About 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate
2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate (PubChem CID 167315242) has the molecular formula C16H31BrNO2+
and a molecular weight of 349.33 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate |
| PubChem CID | 167315242 |
| Molecular Formula | C16H31BrNO2+ |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate |
| SMILES | CC(C)(OC(=O)CCCCCCCBr)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C16H30BrNO2/c1-16(2,14-9-12-18-13-10-14)20-15(19)8-6-4-3-5-7-11-17/h14,18H,3-13H2,1-2H3/p+1 |
| InChIKey | VTNHREXTAUMQQT-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate?
The IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate (CID 167315242) is 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate.
What is the SMILES notation for 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate?
The canonical SMILES for 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate is CC(C)(OC(=O)CCCCCCCBr)C1CC[NH2+]CC1.
What is the InChIKey of 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate?
The InChIKey is VTNHREXTAUMQQT-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H30BrNO2/c1-16(2,14-9-12-18-13-10-14)20-15(19)8-6-4-3-5-7-11-17/h14,18H,3-13H2,1-2H3/p+1.
What are the key properties of 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate?
2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate has a molecular weight of 349.33 g/mol, XLogP of 3.02, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ium-4-ylpropan-2-yl 8-bromooctanoate is sourced from PubChem (CID 167315242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).