About 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate
2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate (PubChem CID 167315018) has the molecular formula C14H28NO2+
and a molecular weight of 242.38 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate |
| PubChem CID | 167315018 |
| Molecular Formula | C14H28NO2+ |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)OC(C)(C)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C14H27NO2/c1-5-11(2)10-13(16)17-14(3,4)12-6-8-15-9-7-12/h11-12,15H,5-10H2,1-4H3/p+1 |
| InChIKey | ZHNWZRIYWZVPCQ-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate?
The IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate (CID 167315018) is 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate.
What is the SMILES notation for 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate?
The canonical SMILES for 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate is CCC(C)CC(=O)OC(C)(C)C1CC[NH2+]CC1.
What is the InChIKey of 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate?
The InChIKey is ZHNWZRIYWZVPCQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H27NO2/c1-5-11(2)10-13(16)17-14(3,4)12-6-8-15-9-7-12/h11-12,15H,5-10H2,1-4H3/p+1.
What are the key properties of 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate?
2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate has a molecular weight of 242.38 g/mol, XLogP of 1.72, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ium-4-ylpropan-2-yl 3-methylpentanoate is sourced from PubChem (CID 167315018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).