C18H27BrNO2+ — CID 167315482
2-piperidin-1-ium-4-ylpropan-2-yl 2-[4-(bromomethyl)phenyl]propanoate (PubChem CID 167315482) has the molecular formula C18H27BrNO2+ and a molecular weight of 369.32 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2-[4-(bromomethyl)phenyl]propanoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-[4-(bromomethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 167315482 |
| Molecular Formula | C18H27BrNO2+ |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-[4-(bromomethyl)phenyl]propanoate |
| SMILES | CC(C(=O)OC(C)(C)C1CC[NH2+]CC1)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C18H26BrNO2/c1-13(15-6-4-14(12-19)5-7-15)17(21)22-18(2,3)16-8-10-20-11-9-16/h4-7,13,16,20H,8-12H2,1-3H3/p+1 |
| InChIKey | UXQWDQNXIPTWNT-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|