C18H28NO2+ — CID 167315286
2-piperidin-1-ium-4-ylpropan-2-yl 2-methyl-2-phenylpropanoate (PubChem CID 167315286) has the molecular formula C18H28NO2+ and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2-methyl-2-phenylpropanoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 167315286 |
| Molecular Formula | C18H28NO2+ |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-methyl-2-phenylpropanoate |
| SMILES | CC(C)(C(=O)OC(C)(C)C1CC[NH2+]CC1)c1ccccc1 |
| InChI | InChI=1S/C18H27NO2/c1-17(2,14-8-6-5-7-9-14)16(20)21-18(3,4)15-10-12-19-13-11-15/h5-9,15,19H,10-13H2,1-4H3/p+1 |
| InChIKey | NDQYQKBYJIBRJC-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |