C20H26NO2+ — CID 167316426
2-piperidin-1-ium-4-ylpropan-2-yl 2-naphthalen-2-ylacetate (PubChem CID 167316426) has the molecular formula C20H26NO2+ and a molecular weight of 312.43 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2-naphthalen-2-ylacetate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-naphthalen-2-ylacetate |
|---|---|
| PubChem CID | 167316426 |
| Molecular Formula | C20H26NO2+ |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-naphthalen-2-ylacetate |
| SMILES | CC(C)(OC(=O)Cc1ccc2ccccc2c1)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C20H25NO2/c1-20(2,18-9-11-21-12-10-18)23-19(22)14-15-7-8-16-5-3-4-6-17(16)13-15/h3-8,13,18,21H,9-12,14H2,1-2H3/p+1 |
| InChIKey | LGGGMOHYMCWLNG-UHFFFAOYSA-O |
| XLogP | 2.68 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |