About 4-tritylpiperidin-1-ium
4-tritylpiperidin-1-ium (PubChem CID 155644615) has the molecular formula C24H26N+
and a molecular weight of 328.48 g/mol. Its IUPAC name is 4-tritylpiperidin-1-ium.
Molecular Properties
| Compound Name | 4-tritylpiperidin-1-ium |
| PubChem CID | 155644615 |
| Molecular Formula | C24H26N+ |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 4-tritylpiperidin-1-ium |
| SMILES | c1ccc(C(c2ccccc2)(c2ccccc2)C2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C24H25N/c1-4-10-20(11-5-1)24(21-12-6-2-7-13-21,22-14-8-3-9-15-22)23-16-18-25-19-17-23/h1-15,23,25H,16-19H2/p+1 |
| InChIKey | CQMJYHJAPDPREI-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-tritylpiperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tritylpiperidin-1-ium?
The IUPAC name of 4-tritylpiperidin-1-ium (CID 155644615) is 4-tritylpiperidin-1-ium.
What is the SMILES notation for 4-tritylpiperidin-1-ium?
The canonical SMILES for 4-tritylpiperidin-1-ium is c1ccc(C(c2ccccc2)(c2ccccc2)C2CC[NH2+]CC2)cc1.
What is the InChIKey of 4-tritylpiperidin-1-ium?
The InChIKey is CQMJYHJAPDPREI-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H25N/c1-4-10-20(11-5-1)24(21-12-6-2-7-13-21,22-14-8-3-9-15-22)23-16-18-25-19-17-23/h1-15,23,25H,16-19H2/p+1.
What are the key properties of 4-tritylpiperidin-1-ium?
4-tritylpiperidin-1-ium has a molecular weight of 328.48 g/mol, XLogP of 3.99, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tritylpiperidin-1-ium is sourced from PubChem (CID 155644615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).