About [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid
[diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid (PubChem CID 159354633) has the molecular formula C29H33NO
and a molecular weight of 411.59 g/mol. Its IUPAC name is [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid.
Molecular Properties
| Compound Name | [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid |
| PubChem CID | 159354633 |
| Molecular Formula | C29H33NO |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid |
| SMILES | CC(C)C1CCC(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1.N=C=O |
| InChI | InChI=1S/C28H32.CHNO/c1-22(2)23-18-20-27(21-19-23)28(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26;2-1-3/h3-17,22-23,27H,18-21H2,1-2H3;2H |
| InChIKey | LHTQATLGTPEJPI-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid?
The IUPAC name of [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid (CID 159354633) is [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid.
What is the SMILES notation for [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid?
The canonical SMILES for [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid is CC(C)C1CCC(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1.N=C=O.
What is the InChIKey of [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid?
The InChIKey is LHTQATLGTPEJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32.CHNO/c1-22(2)23-18-20-27(21-19-23)28(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26;2-1-3/h3-17,22-23,27H,18-21H2,1-2H3;2H.
What are the key properties of [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid?
[diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid has a molecular weight of 411.59 g/mol, XLogP of 7.38, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [diphenyl-(4-propan-2-ylcyclohexyl)methyl]benzene;isocyanic acid is sourced from PubChem (CID 159354633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).