C16H21NO3S — CID 162414777
4-[(2R)-2-cyclopropyl-2-methoxy-2-phenylethyl]sulfonylbutanenitrile (PubChem CID 162414777) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-[(2R)-2-cyclopropyl-2-methoxy-2-phenylethyl]sulfonylbutanenitrile.
| Compound Name | 4-[(2R)-2-cyclopropyl-2-methoxy-2-phenylethyl]sulfonylbutanenitrile |
|---|---|
| PubChem CID | 162414777 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[(2R)-2-cyclopropyl-2-methoxy-2-phenylethyl]sulfonylbutanenitrile |
| SMILES | CO[C@@](CS(=O)(=O)CCCC#N)(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C16H21NO3S/c1-20-16(15-9-10-15,14-7-3-2-4-8-14)13-21(18,19)12-6-5-11-17/h2-4,7-8,15H,5-6,9-10,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | XUYHMKTVEZUEAS-INIZCTEOSA-N |
| XLogP | 2.66 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|