C18H30O3S — CID 158308844
[1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2-methylpropan-2-yl]benzene (PubChem CID 158308844) has the molecular formula C18H30O3S and a molecular weight of 326.50 g/mol. Its IUPAC name is [1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2-methylpropan-2-yl]benzene.
| Compound Name | [1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2-methylpropan-2-yl]benzene |
|---|---|
| PubChem CID | 158308844 |
| Molecular Formula | C18H30O3S |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2-methylpropan-2-yl]benzene |
| SMILES | CC(C)(C)COCCCS(=O)(=O)CC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H30O3S/c1-17(2,3)14-21-12-9-13-22(19,20)15-18(4,5)16-10-7-6-8-11-16/h6-8,10-11H,9,12-15H2,1-5H3 |
| InChIKey | NMWKBYROEXFJNH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|