C16H27NO3S — CID 146353112
3-(2-methylpropoxy)-N-(2-phenylpropan-2-yl)propane-1-sulfonamide (PubChem CID 146353112) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is 3-(2-methylpropoxy)-N-(2-phenylpropan-2-yl)propane-1-sulfonamide.
| Compound Name | 3-(2-methylpropoxy)-N-(2-phenylpropan-2-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 146353112 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3-(2-methylpropoxy)-N-(2-phenylpropan-2-yl)propane-1-sulfonamide |
| SMILES | CC(C)COCCCS(=O)(=O)NC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H27NO3S/c1-14(2)13-20-11-8-12-21(18,19)17-16(3,4)15-9-6-5-7-10-15/h5-7,9-10,14,17H,8,11-13H2,1-4H3 |
| InChIKey | WLUZYWANUUTSIK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|