C34H47N2O6PS — CID 70018827
3-[2-[3,3-bis(4-methoxyphenyl)-3-phenylpropyl]sulfonylethyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile (PubChem CID 70018827) has the molecular formula C34H47N2O6PS and a molecular weight of 642.80 g/mol. Its IUPAC name is 3-[2-[3,3-bis(4-methoxyphenyl)-3-phenylpropyl]sulfonylethyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile.
| Compound Name | 3-[2-[3,3-bis(4-methoxyphenyl)-3-phenylpropyl]sulfonylethyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile |
|---|---|
| PubChem CID | 70018827 |
| Molecular Formula | C34H47N2O6PS |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | 3-[2-[3,3-bis(4-methoxyphenyl)-3-phenylpropyl]sulfonylethyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile |
| SMILES | COc1ccc(C(CCS(=O)(=O)CCP(O)(O)(CCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H47N2O6PS/c1-27(2)36(28(3)4)43(37,38,23-10-22-35)24-26-44(39,40)25-21-34(29-11-8-7-9-12-29,30-13-17-32(41-5)18-14-30)31-15-19-33(42-6)20-16-31/h7-9,11-20,27-28,37-38H,10,21,23-26H2,1-6H3 |
| InChIKey | SLDRNPPVSYFRRJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|