C32H41N2O3PS — CID 170946196
3-[2-[bis(4-methoxyphenyl)-phenylmethyl]sulfanylethyl-di(propan-2-yl)phosphorylamino]propanenitrile (PubChem CID 170946196) has the molecular formula C32H41N2O3PS and a molecular weight of 564.73 g/mol. Its IUPAC name is 3-[2-[bis(4-methoxyphenyl)-phenylmethyl]sulfanylethyl-di(propan-2-yl)phosphorylamino]propanenitrile.
| Compound Name | 3-[2-[bis(4-methoxyphenyl)-phenylmethyl]sulfanylethyl-di(propan-2-yl)phosphorylamino]propanenitrile |
|---|---|
| PubChem CID | 170946196 |
| Molecular Formula | C32H41N2O3PS |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 3-[2-[bis(4-methoxyphenyl)-phenylmethyl]sulfanylethyl-di(propan-2-yl)phosphorylamino]propanenitrile |
| SMILES | COc1ccc(C(SCCN(CCC#N)P(=O)(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H41N2O3PS/c1-25(2)38(35,26(3)4)34(22-10-21-33)23-24-39-32(27-11-8-7-9-12-27,28-13-17-30(36-5)18-14-28)29-15-19-31(37-6)20-16-29/h7-9,11-20,25-26H,10,22-24H2,1-6H3 |
| InChIKey | ZHXYEYGJQJESJY-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|