C40H50N5O4P — CID 155663665
3-[[(1S,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(pyrimidin-4-ylamino)cyclopentyl]-di(propan-2-yl)phosphorylamino]propanenitrile (PubChem CID 155663665) has the molecular formula C40H50N5O4P and a molecular weight of 695.85 g/mol. Its IUPAC name is 3-[[(1S,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(pyrimidin-4-ylamino)cyclopentyl]-di(propan-2-yl)phosphorylamino]propanenitrile.
| Compound Name | 3-[[(1S,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(pyrimidin-4-ylamino)cyclopentyl]-di(propan-2-yl)phosphorylamino]propanenitrile |
|---|---|
| PubChem CID | 155663665 |
| Molecular Formula | C40H50N5O4P |
| Molecular Weight | 695.85 g/mol |
| Exact Mass | 695.36 |
| IUPAC Name | 3-[[(1S,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(pyrimidin-4-ylamino)cyclopentyl]-di(propan-2-yl)phosphorylamino]propanenitrile |
| SMILES | COc1ccc(C(OC[C@@H]2C[C@@H](Nc3ccncn3)C[C@@H]2N(CCC#N)P(=O)(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H50N5O4P/c1-29(2)50(46,30(3)4)45(24-10-22-41)38-26-35(44-39-21-23-42-28-43-39)25-31(38)27-49-40(32-11-8-7-9-12-32,33-13-17-36(47-5)18-14-33)34-15-19-37(48-6)20-16-34/h7-9,11-21,23,28-31,35,38H,10,24-27H2,1-6H3,(H,42,43,44)/t31-,35+,38-/m0/s1 |
| InChIKey | HRQVGVULFUAXQO-KYPJSTPHSA-N |
| XLogP | 8.37 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.85 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|