C31H32N2O7P+ — CID 155095251
[(1R,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-pyrimidin-4-yloxycyclopentyl]oxy-hydroxy-oxophosphanium (PubChem CID 155095251) has the molecular formula C31H32N2O7P+ and a molecular weight of 575.58 g/mol. Its IUPAC name is [(1R,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-pyrimidin-4-yloxycyclopentyl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(1R,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-pyrimidin-4-yloxycyclopentyl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 155095251 |
| Molecular Formula | C31H32N2O7P+ |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | [(1R,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-pyrimidin-4-yloxycyclopentyl]oxy-hydroxy-oxophosphanium |
| SMILES | COc1ccc(C(OC[C@H]2C[C@@H](Oc3ccncn3)C[C@H]2O[P+](=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H31N2O7P/c1-36-26-12-8-24(9-13-26)31(23-6-4-3-5-7-23,25-10-14-27(37-2)15-11-25)38-20-22-18-28(19-29(22)40-41(34)35)39-30-16-17-32-21-33-30/h3-17,21-22,28-29H,18-20H2,1-2H3/p+1/t22-,28-,29-/m1/s1 |
| InChIKey | COHOSKRHVLEZTM-RNOQYBQRSA-O |
| XLogP | 5.69 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|