C32H36B2O11P2 — CID 146027478
CID 146027478 (PubChem CID 146027478) has the molecular formula C32H36B2O11P2 and a molecular weight of 680.20 g/mol.
| Compound Name | CID 146027478 |
|---|---|
| PubChem CID | 146027478 |
| Molecular Formula | C32H36B2O11P2 |
| Molecular Weight | 680.20 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](O[P+](=O)[O-])[C@@H](COP(=C)(O)O[C@@H]2C[C@H]([B])O[C@@H]2COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C32H36B2O11P2/c1-38-24-13-9-22(10-14-24)32(21-7-5-4-6-8-21,23-11-15-25(39-2)16-12-23)40-19-28-27(18-31(34)42-28)45-47(3,37)41-20-29-26(44-46(35)36)17-30(33)43-29/h4-16,26-31,37H,3,17-20H2,1-2H3/t26-,27-,28-,29-,30-,31-,47?/m1/s1 |
| InChIKey | XTHBFHZEFAYRFN-GOGIVBRNSA-N |
| XLogP | 3.57 |
| TPSA | 134.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|