C32H32N4O4 — CID 155767325
(1S,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-purin-9-ylcyclopentan-1-ol (PubChem CID 155767325) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is (1S,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-purin-9-ylcyclopentan-1-ol.
| Compound Name | (1S,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-purin-9-ylcyclopentan-1-ol |
|---|---|
| PubChem CID | 155767325 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (1S,2R,4R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-purin-9-ylcyclopentan-1-ol |
| SMILES | COc1ccc(C(OC[C@H]2C[C@@H](n3cnc4cncnc43)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H32N4O4/c1-38-27-12-8-24(9-13-27)32(23-6-4-3-5-7-23,25-10-14-28(39-2)15-11-25)40-19-22-16-26(17-30(22)37)36-21-35-29-18-33-20-34-31(29)36/h3-15,18,20-22,26,30,37H,16-17,19H2,1-2H3/t22-,26-,30+/m1/s1 |
| InChIKey | DDFBOFRYCHVSLO-AUUGNALLSA-N |
| XLogP | 5.16 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|