C38H46N6O4S — CID 22115778
2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentan-1-ol (PubChem CID 22115778) has the molecular formula C38H46N6O4S and a molecular weight of 682.89 g/mol. Its IUPAC name is 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentan-1-ol.
| Compound Name | 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 22115778 |
| Molecular Formula | C38H46N6O4S |
| Molecular Weight | 682.89 g/mol |
| Exact Mass | 682.33 |
| IUPAC Name | 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentan-1-ol |
| SMILES | CCCCNc1nc(SCCC)nc2c1nnn2C1CC(O)C(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C38H46N6O4S/c1-5-7-21-39-35-34-36(41-37(40-35)49-22-6-2)44(43-42-34)30-23-26(33(45)24-30)25-48-38(27-11-9-8-10-12-27,28-13-17-31(46-3)18-14-28)29-15-19-32(47-4)20-16-29/h8-20,26,30,33,45H,5-7,21-25H2,1-4H3,(H,39,40,41) |
| InChIKey | CXSUPNQFVVUMAC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.89 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|