C20H25N7O4S — CID 122192515
(1S,2R,3S,4R)-4-[7-[(2E)-2-[(2-methoxyphenyl)methylidene]hydrazinyl]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol (PubChem CID 122192515) has the molecular formula C20H25N7O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is (1S,2R,3S,4R)-4-[7-[(2E)-2-[(2-methoxyphenyl)methylidene]hydrazinyl]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol.
| Compound Name | (1S,2R,3S,4R)-4-[7-[(2E)-2-[(2-methoxyphenyl)methylidene]hydrazinyl]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 122192515 |
| Molecular Formula | C20H25N7O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (1S,2R,3S,4R)-4-[7-[(2E)-2-[(2-methoxyphenyl)methylidene]hydrazinyl]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2,3-triol |
| SMILES | CCCSc1nc(N/N=C/c2ccccc2OC)c2nnn([C@@H]3C[C@H](O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C20H25N7O4S/c1-3-8-32-20-22-18(25-21-10-11-6-4-5-7-14(11)31-2)15-19(23-20)27(26-24-15)12-9-13(28)17(30)16(12)29/h4-7,10,12-13,16-17,28-30H,3,8-9H2,1-2H3,(H,22,23,25)/b21-10+/t12-,13+,16+,17-/m1/s1 |
| InChIKey | YXOVSNMLVLVIQI-RCTXDHMYSA-N |
| XLogP | 1.21 |
| TPSA | 150.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|