C40H49N2O4P — CID 171483547
3-[2-[4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]phenyl]ethyl-di(propan-2-yl)phosphorylamino]propanenitrile (PubChem CID 171483547) has the molecular formula C40H49N2O4P and a molecular weight of 652.82 g/mol. Its IUPAC name is 3-[2-[4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]phenyl]ethyl-di(propan-2-yl)phosphorylamino]propanenitrile.
| Compound Name | 3-[2-[4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]phenyl]ethyl-di(propan-2-yl)phosphorylamino]propanenitrile |
|---|---|
| PubChem CID | 171483547 |
| Molecular Formula | C40H49N2O4P |
| Molecular Weight | 652.82 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | 3-[2-[4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]phenyl]ethyl-di(propan-2-yl)phosphorylamino]propanenitrile |
| SMILES | COc1ccc(C(OCCc2ccc(CCN(CCC#N)P(=O)(C(C)C)C(C)C)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H49N2O4P/c1-31(2)47(43,32(3)4)42(28-10-27-41)29-25-33-13-15-34(16-14-33)26-30-46-40(35-11-8-7-9-12-35,36-17-21-38(44-5)22-18-36)37-19-23-39(45-6)24-20-37/h7-9,11-24,31-32H,10,25-26,28-30H2,1-6H3 |
| InChIKey | UQXGKLQXVABGMU-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.82 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|