C17H24NO3+ — CID 167316175
2-piperidin-1-ium-4-ylpropan-2-yl 4-acetylbenzoate (PubChem CID 167316175) has the molecular formula C17H24NO3+ and a molecular weight of 290.38 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 4-acetylbenzoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 4-acetylbenzoate |
|---|---|
| PubChem CID | 167316175 |
| Molecular Formula | C17H24NO3+ |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 4-acetylbenzoate |
| SMILES | CC(=O)c1ccc(C(=O)OC(C)(C)C2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-12(19)13-4-6-14(7-5-13)16(20)21-17(2,3)15-8-10-18-11-9-15/h4-7,15,18H,8-11H2,1-3H3/p+1 |
| InChIKey | HRJNMHZKNICJKJ-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 59.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |