About 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate
2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate (PubChem CID 167315730) has the molecular formula C17H26NO2+
and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate |
| PubChem CID | 167315730 |
| Molecular Formula | C17H26NO2+ |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate |
| SMILES | Cc1cccc(C)c1C(=O)OC(C)(C)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C17H25NO2/c1-12-6-5-7-13(2)15(12)16(19)20-17(3,4)14-8-10-18-11-9-14/h5-7,14,18H,8-11H2,1-4H3/p+1 |
| InChIKey | AMHMXRDFXUPFCP-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate?
The IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate (CID 167315730) is 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate.
What is the SMILES notation for 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate?
The canonical SMILES for 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate is Cc1cccc(C)c1C(=O)OC(C)(C)C1CC[NH2+]CC1.
What is the InChIKey of 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate?
The InChIKey is AMHMXRDFXUPFCP-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H25NO2/c1-12-6-5-7-13(2)15(12)16(19)20-17(3,4)14-8-10-18-11-9-14/h5-7,14,18H,8-11H2,1-4H3/p+1.
What are the key properties of 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate?
2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate has a molecular weight of 276.40 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ium-4-ylpropan-2-yl 2,6-dimethylbenzoate is sourced from PubChem (CID 167315730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).