C15H21N2O5+ — CID 167316317
2-piperidin-1-ium-4-ylpropan-2-yl 3-hydroxy-2-nitrobenzoate (PubChem CID 167316317) has the molecular formula C15H21N2O5+ and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 3-hydroxy-2-nitrobenzoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-hydroxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 167316317 |
| Molecular Formula | C15H21N2O5+ |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-hydroxy-2-nitrobenzoate |
| SMILES | CC(C)(OC(=O)c1cccc(O)c1[N+](=O)[O-])C1CC[NH2+]CC1 |
| InChI | InChI=1S/C15H20N2O5/c1-15(2,10-6-8-16-9-7-10)22-14(19)11-4-3-5-12(18)13(11)17(20)21/h3-5,10,16,18H,6-9H2,1-2H3/p+1 |
| InChIKey | JYPPWRVOSNULSS-UHFFFAOYSA-O |
| XLogP | 1.21 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|