About 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate
2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate (PubChem CID 167315168) has the molecular formula C17H27N2O2+
and a molecular weight of 291.41 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate |
| PubChem CID | 167315168 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OC(C)(C)C2CC[NH2+]CC2)c(N)c1C |
| InChI | InChI=1S/C17H26N2O2/c1-11-5-6-14(15(18)12(11)2)16(20)21-17(3,4)13-7-9-19-10-8-13/h5-6,13,19H,7-10,18H2,1-4H3/p+1 |
| InChIKey | PRYHDXMOMJZNNC-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate?
The IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate (CID 167315168) is 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate.
What is the SMILES notation for 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate?
The canonical SMILES for 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate is Cc1ccc(C(=O)OC(C)(C)C2CC[NH2+]CC2)c(N)c1C.
What is the InChIKey of 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate?
The InChIKey is PRYHDXMOMJZNNC-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H26N2O2/c1-11-5-6-14(15(18)12(11)2)16(20)21-17(3,4)13-7-9-19-10-8-13/h5-6,13,19H,7-10,18H2,1-4H3/p+1.
What are the key properties of 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate?
2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate has a molecular weight of 291.41 g/mol, XLogP of 1.79, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ium-4-ylpropan-2-yl 2-amino-3,4-dimethylbenzoate is sourced from PubChem (CID 167315168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).