C18H25ClNO3+ — CID 167315647
2-piperidin-1-ium-4-ylpropan-2-yl 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 167315647) has the molecular formula C18H25ClNO3+ and a molecular weight of 338.86 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 167315647 |
| Molecular Formula | C18H25ClNO3+ |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | CC(C)(OC(=O)CCC(=O)c1ccc(Cl)cc1)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C18H24ClNO3/c1-18(2,14-9-11-20-12-10-14)23-17(22)8-7-16(21)13-3-5-15(19)6-4-13/h3-6,14,20H,7-12H2,1-2H3/p+1 |
| InChIKey | YTTYKACEKVCURT-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 59.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |