C22H42N2O4S+2 — CID 167315041
2-piperidin-1-ium-4-ylpropan-2-yl 3-[3-oxo-3-(2-piperidin-1-ium-4-ylpropan-2-yloxy)propyl]sulfanylpropanoate (PubChem CID 167315041) has the molecular formula C22H42N2O4S+2 and a molecular weight of 430.66 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 3-[3-oxo-3-(2-piperidin-1-ium-4-ylpropan-2-yloxy)propyl]sulfanylpropanoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-[3-oxo-3-(2-piperidin-1-ium-4-ylpropan-2-yloxy)propyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 167315041 |
| Molecular Formula | C22H42N2O4S+2 |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-[3-oxo-3-(2-piperidin-1-ium-4-ylpropan-2-yloxy)propyl]sulfanylpropanoate |
| SMILES | CC(C)(OC(=O)CCSCCC(=O)OC(C)(C)C1CC[NH2+]CC1)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C22H40N2O4S/c1-21(2,17-5-11-23-12-6-17)27-19(25)9-15-29-16-10-20(26)28-22(3,4)18-7-13-24-14-8-18/h17-18,23-24H,5-16H2,1-4H3/p+2 |
| InChIKey | NTOMLKARYLERSK-UHFFFAOYSA-P |
| XLogP | 1.09 |
| TPSA | 85.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|