About 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate
2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate (PubChem CID 162508102) has the molecular formula C10H19INO2+
and a molecular weight of 312.17 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate.
Molecular Properties
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate |
| PubChem CID | 162508102 |
| Molecular Formula | C10H19INO2+ |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate |
| SMILES | CC(C)(OC(=O)CI)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C10H18INO2/c1-10(2,14-9(13)7-11)8-3-5-12-6-4-8/h8,12H,3-7H2,1-2H3/p+1 |
| InChIKey | UKRYCRAPEQIZFP-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate?
The IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate (CID 162508102) is 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate.
What is the SMILES notation for 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate?
The canonical SMILES for 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate is CC(C)(OC(=O)CI)C1CC[NH2+]CC1.
What is the InChIKey of 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate?
The InChIKey is UKRYCRAPEQIZFP-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H18INO2/c1-10(2,14-9(13)7-11)8-3-5-12-6-4-8/h8,12H,3-7H2,1-2H3/p+1.
What are the key properties of 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate?
2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate has a molecular weight of 312.17 g/mol, XLogP of 0.72, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ium-4-ylpropan-2-yl 2-iodoacetate is sourced from PubChem (CID 162508102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).