About 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate
2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate (PubChem CID 167316028) has the molecular formula C11H19FNO2+
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate |
| PubChem CID | 167316028 |
| Molecular Formula | C11H19FNO2+ |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OC(C)(C)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C11H18FNO2/c1-8(12)10(14)15-11(2,3)9-4-6-13-7-5-9/h9,13H,1,4-7H2,2-3H3/p+1 |
| InChIKey | DQFFIOUJTZXJKT-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate?
The IUPAC name of 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate (CID 167316028) is 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate.
What is the SMILES notation for 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate?
The canonical SMILES for 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate is C=C(F)C(=O)OC(C)(C)C1CC[NH2+]CC1.
What is the InChIKey of 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate?
The InChIKey is DQFFIOUJTZXJKT-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H18FNO2/c1-8(12)10(14)15-11(2,3)9-4-6-13-7-5-9/h9,13H,1,4-7H2,2-3H3/p+1.
What are the key properties of 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate?
2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate has a molecular weight of 216.28 g/mol, XLogP of 0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ium-4-ylpropan-2-yl 2-fluoroprop-2-enoate is sourced from PubChem (CID 167316028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).