C19H36NO2+ — CID 167314636
2-piperidin-1-ium-4-ylpropan-2-yl 4-tert-butylcyclohexane-1-carboxylate (PubChem CID 167314636) has the molecular formula C19H36NO2+ and a molecular weight of 310.50 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 167314636 |
| Molecular Formula | C19H36NO2+ |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 4-tert-butylcyclohexane-1-carboxylate |
| SMILES | CC(C)(C)C1CCC(C(=O)OC(C)(C)C2CC[NH2+]CC2)CC1 |
| InChI | InChI=1S/C19H35NO2/c1-18(2,3)15-8-6-14(7-9-15)17(21)22-19(4,5)16-10-12-20-13-11-16/h14-16,20H,6-13H2,1-5H3/p+1 |
| InChIKey | UQFAWXPXVZFABA-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |