C15H26NO2+ — CID 167314935
2-piperidin-1-ium-4-ylpropan-2-yl cyclohex-3-ene-1-carboxylate (PubChem CID 167314935) has the molecular formula C15H26NO2+ and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl cyclohex-3-ene-1-carboxylate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 167314935 |
| Molecular Formula | C15H26NO2+ |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl cyclohex-3-ene-1-carboxylate |
| SMILES | CC(C)(OC(=O)C1CC=CCC1)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C15H25NO2/c1-15(2,13-8-10-16-11-9-13)18-14(17)12-6-4-3-5-7-12/h3-4,12-13,16H,5-11H2,1-2H3/p+1 |
| InChIKey | PPPNEYHJVZPSOT-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|